C23H27NO4 — CID 3033107
2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-methylchromen-4-one (PubChem CID 3033107) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-methylchromen-4-one.
| Compound Name | 2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-methylchromen-4-one |
|---|---|
| PubChem CID | 3033107 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-methylchromen-4-one |
| SMILES | Cc1c(-c2ccc(OCC(O)CNC(C)(C)C)cc2)oc2ccccc2c1=O |
| InChI | InChI=1S/C23H27NO4/c1-15-21(26)19-7-5-6-8-20(19)28-22(15)16-9-11-18(12-10-16)27-14-17(25)13-24-23(2,3)4/h5-12,17,24-25H,13-14H2,1-4H3 |
| InChIKey | IURAAQXYILAPPL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |