C30H25NO4 — CID 14626335
7-(3-anilino-2-hydroxypropoxy)-2,3-diphenylchromen-4-one (PubChem CID 14626335) has the molecular formula C30H25NO4 and a molecular weight of 463.53 g/mol. Its IUPAC name is 7-(3-anilino-2-hydroxypropoxy)-2,3-diphenylchromen-4-one.
| Compound Name | 7-(3-anilino-2-hydroxypropoxy)-2,3-diphenylchromen-4-one |
|---|---|
| PubChem CID | 14626335 |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 7-(3-anilino-2-hydroxypropoxy)-2,3-diphenylchromen-4-one |
| SMILES | O=c1c(-c2ccccc2)c(-c2ccccc2)oc2cc(OCC(O)CNc3ccccc3)ccc12 |
| InChI | InChI=1S/C30H25NO4/c32-24(19-31-23-14-8-3-9-15-23)20-34-25-16-17-26-27(18-25)35-30(22-12-6-2-7-13-22)28(29(26)33)21-10-4-1-5-11-21/h1-18,24,31-32H,19-20H2 |
| InChIKey | YCXGMGKLPSVECJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |