C22H22F3NO4 — CID 70448638
7-[2-hydroxy-2-(propan-2-ylamino)propoxy]-3-phenyl-2-(trifluoromethyl)chromen-4-one (PubChem CID 70448638) has the molecular formula C22H22F3NO4 and a molecular weight of 421.42 g/mol. Its IUPAC name is 7-[2-hydroxy-2-(propan-2-ylamino)propoxy]-3-phenyl-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 7-[2-hydroxy-2-(propan-2-ylamino)propoxy]-3-phenyl-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 70448638 |
| Molecular Formula | C22H22F3NO4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 7-[2-hydroxy-2-(propan-2-ylamino)propoxy]-3-phenyl-2-(trifluoromethyl)chromen-4-one |
| SMILES | CC(C)NC(C)(O)COc1ccc2c(=O)c(-c3ccccc3)c(C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C22H22F3NO4/c1-13(2)26-21(3,28)12-29-15-9-10-16-17(11-15)30-20(22(23,24)25)18(19(16)27)14-7-5-4-6-8-14/h4-11,13,26,28H,12H2,1-3H3 |
| InChIKey | KWAWZCLWDFJHCZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|