C20H13F3O4 — CID 2036381
[4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] cyclopropanecarboxylate (PubChem CID 2036381) has the molecular formula C20H13F3O4 and a molecular weight of 374.31 g/mol. Its IUPAC name is [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] cyclopropanecarboxylate.
| Compound Name | [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 2036381 |
| Molecular Formula | C20H13F3O4 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] cyclopropanecarboxylate |
| SMILES | O=C(Oc1ccc2c(=O)c(-c3ccccc3)c(C(F)(F)F)oc2c1)C1CC1 |
| InChI | InChI=1S/C20H13F3O4/c21-20(22,23)18-16(11-4-2-1-3-5-11)17(24)14-9-8-13(10-15(14)27-18)26-19(25)12-6-7-12/h1-5,8-10,12H,6-7H2 |
| InChIKey | QZOFXTUSTILGMW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|