C25H12Cl3F3O4 — CID 3701750
[3-(4-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 3701750) has the molecular formula C25H12Cl3F3O4 and a molecular weight of 539.72 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [3-(4-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3701750 |
| Molecular Formula | C25H12Cl3F3O4 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | [3-(4-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)Oc1ccc2c(=O)c(-c3ccc(Cl)cc3)c(C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C25H12Cl3F3O4/c26-15-5-3-14(4-6-15)22-23(33)17-8-7-16(12-20(17)35-24(22)25(29,30)31)34-21(32)10-2-13-1-9-18(27)19(28)11-13/h1-12H |
| InChIKey | HHXDQCXAUZAWEO-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|