C30H24ClF3O5 — CID 3680436
[3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(4-propan-2-ylphenyl)prop-2-enoate (PubChem CID 3680436) has the molecular formula C30H24ClF3O5 and a molecular weight of 556.96 g/mol. Its IUPAC name is [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(4-propan-2-ylphenyl)prop-2-enoate.
| Compound Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(4-propan-2-ylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3680436 |
| Molecular Formula | C30H24ClF3O5 |
| Molecular Weight | 556.96 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(4-propan-2-ylphenyl)prop-2-enoate |
| SMILES | Cc1cc(Oc2c(C(F)(F)F)oc3cc(OC(=O)C=Cc4ccc(C(C)C)cc4)ccc3c2=O)cc(C)c1Cl |
| InChI | InChI=1S/C30H24ClF3O5/c1-16(2)20-8-5-19(6-9-20)7-12-25(35)37-21-10-11-23-24(15-21)39-29(30(32,33)34)28(27(23)36)38-22-13-17(3)26(31)18(4)14-22/h5-16H,1-4H3 |
| InChIKey | VAAUPDJZKVBCSL-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.96 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|