C37H40F3NO5 — CID 7905496
[8-[[bis(2-methylpropyl)amino]methyl]-3-(3,4-dimethylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 7905496) has the molecular formula C37H40F3NO5 and a molecular weight of 635.72 g/mol. Its IUPAC name is [8-[[bis(2-methylpropyl)amino]methyl]-3-(3,4-dimethylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [8-[[bis(2-methylpropyl)amino]methyl]-3-(3,4-dimethylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7905496 |
| Molecular Formula | C37H40F3NO5 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | [8-[[bis(2-methylpropyl)amino]methyl]-3-(3,4-dimethylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)Oc2ccc3c(=O)c(Oc4ccc(C)c(C)c4)c(C(F)(F)F)oc3c2CN(CC(C)C)CC(C)C)cc1 |
| InChI | InChI=1S/C37H40F3NO5/c1-22(2)19-41(20-23(3)4)21-30-31(45-32(42)17-13-27-11-8-24(5)9-12-27)16-15-29-33(43)35(36(37(38,39)40)46-34(29)30)44-28-14-10-25(6)26(7)18-28/h8-18,22-23H,19-21H2,1-7H3/b17-13+ |
| InChIKey | YRMQRPPHWICIDV-GHRIWEEISA-N |
| XLogP | 9.26 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|