C39H44F3NO7 — CID 71967273
[8-[[bis(2-methylpropyl)amino]methyl]-4-oxo-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 71967273) has the molecular formula C39H44F3NO7 and a molecular weight of 695.78 g/mol. Its IUPAC name is [8-[[bis(2-methylpropyl)amino]methyl]-4-oxo-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [8-[[bis(2-methylpropyl)amino]methyl]-4-oxo-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71967273 |
| Molecular Formula | C39H44F3NO7 |
| Molecular Weight | 695.78 g/mol |
| Exact Mass | 695.31 |
| IUPAC Name | [8-[[bis(2-methylpropyl)amino]methyl]-4-oxo-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCCc1ccc(Oc2c(C(F)(F)F)oc3c(CN(CC(C)C)CC(C)C)c(OC(=O)C=Cc4ccc(OC)c(OC)c4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C39H44F3NO7/c1-8-9-26-10-14-28(15-11-26)48-37-35(45)29-16-18-31(49-34(44)19-13-27-12-17-32(46-6)33(20-27)47-7)30(36(29)50-38(37)39(40,41)42)23-43(21-24(2)3)22-25(4)5/h10-20,24-25H,8-9,21-23H2,1-7H3 |
| InChIKey | ZEJVLLONXANWDZ-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 87.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.78 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|