C34H34ClF3NO5+ — CID 7905493
[3-(4-chlorophenoxy)-4-oxo-7-[(E)-3-phenylprop-2-enoyl]oxy-2-(trifluoromethyl)chromen-8-yl]methyl-bis(2-methylpropyl)azanium (PubChem CID 7905493) has the molecular formula C34H34ClF3NO5+ and a molecular weight of 629.10 g/mol. Its IUPAC name is [3-(4-chlorophenoxy)-4-oxo-7-[(E)-3-phenylprop-2-enoyl]oxy-2-(trifluoromethyl)chromen-8-yl]methyl-bis(2-methylpropyl)azanium.
| Compound Name | [3-(4-chlorophenoxy)-4-oxo-7-[(E)-3-phenylprop-2-enoyl]oxy-2-(trifluoromethyl)chromen-8-yl]methyl-bis(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 7905493 |
| Molecular Formula | C34H34ClF3NO5+ |
| Molecular Weight | 629.10 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | [3-(4-chlorophenoxy)-4-oxo-7-[(E)-3-phenylprop-2-enoyl]oxy-2-(trifluoromethyl)chromen-8-yl]methyl-bis(2-methylpropyl)azanium |
| SMILES | CC(C)C[NH+](Cc1c(OC(=O)/C=C/c2ccccc2)ccc2c(=O)c(Oc3ccc(Cl)cc3)c(C(F)(F)F)oc12)CC(C)C |
| InChI | InChI=1S/C34H33ClF3NO5/c1-21(2)18-39(19-22(3)4)20-27-28(43-29(40)17-10-23-8-6-5-7-9-23)16-15-26-30(41)32(33(34(36,37)38)44-31(26)27)42-25-13-11-24(35)12-14-25/h5-17,21-22H,18-20H2,1-4H3/p+1/b17-10+ |
| InChIKey | PYDPJJRXZSMNRH-LICLKQGHSA-O |
| XLogP | 7.57 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.10 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|