C31H28ClF3NO6+ — CID 7905527
[3-(4-chlorophenoxy)-4-oxo-8-(piperidin-1-ium-1-ylmethyl)-2-(trifluoromethyl)chromen-7-yl] 4-ethoxybenzoate (PubChem CID 7905527) has the molecular formula C31H28ClF3NO6+ and a molecular weight of 603.01 g/mol. Its IUPAC name is [3-(4-chlorophenoxy)-4-oxo-8-(piperidin-1-ium-1-ylmethyl)-2-(trifluoromethyl)chromen-7-yl] 4-ethoxybenzoate.
| Compound Name | [3-(4-chlorophenoxy)-4-oxo-8-(piperidin-1-ium-1-ylmethyl)-2-(trifluoromethyl)chromen-7-yl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 7905527 |
| Molecular Formula | C31H28ClF3NO6+ |
| Molecular Weight | 603.01 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | [3-(4-chlorophenoxy)-4-oxo-8-(piperidin-1-ium-1-ylmethyl)-2-(trifluoromethyl)chromen-7-yl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc3c(=O)c(Oc4ccc(Cl)cc4)c(C(F)(F)F)oc3c2C[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C31H27ClF3NO6/c1-2-39-21-10-6-19(7-11-21)30(38)41-25-15-14-23-26(37)28(40-22-12-8-20(32)9-13-22)29(31(33,34)35)42-27(23)24(25)18-36-16-4-3-5-17-36/h6-15H,2-5,16-18H2,1H3/p+1 |
| InChIKey | YNNIWBCQHOWUFK-UHFFFAOYSA-O |
| XLogP | 6.44 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.01 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|