C36H39F3NO5+ — CID 7905441
[4-oxo-8-(piperidin-1-ium-1-ylmethyl)-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 4-tert-butylbenzoate (PubChem CID 7905441) has the molecular formula C36H39F3NO5+ and a molecular weight of 622.70 g/mol. Its IUPAC name is [4-oxo-8-(piperidin-1-ium-1-ylmethyl)-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 4-tert-butylbenzoate.
| Compound Name | [4-oxo-8-(piperidin-1-ium-1-ylmethyl)-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 7905441 |
| Molecular Formula | C36H39F3NO5+ |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | [4-oxo-8-(piperidin-1-ium-1-ylmethyl)-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 4-tert-butylbenzoate |
| SMILES | CCCc1ccc(Oc2c(C(F)(F)F)oc3c(C[NH+]4CCCCC4)c(OC(=O)c4ccc(C(C)(C)C)cc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C36H38F3NO5/c1-5-9-23-10-16-26(17-11-23)43-32-30(41)27-18-19-29(44-34(42)24-12-14-25(15-13-24)35(2,3)4)28(22-40-20-7-6-8-21-40)31(27)45-33(32)36(37,38)39/h10-19H,5-9,20-22H2,1-4H3/p+1 |
| InChIKey | ZXVLYMDPBUNHCQ-UHFFFAOYSA-O |
| XLogP | 7.64 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|