C33H33F3NO7+ — CID 7905505
[8-(morpholin-4-ium-4-ylmethyl)-4-oxo-2-(trifluoromethyl)-3-(2,3,5-trimethylphenoxy)chromen-7-yl] 4-ethoxybenzoate (PubChem CID 7905505) has the molecular formula C33H33F3NO7+ and a molecular weight of 612.62 g/mol. Its IUPAC name is [8-(morpholin-4-ium-4-ylmethyl)-4-oxo-2-(trifluoromethyl)-3-(2,3,5-trimethylphenoxy)chromen-7-yl] 4-ethoxybenzoate.
| Compound Name | [8-(morpholin-4-ium-4-ylmethyl)-4-oxo-2-(trifluoromethyl)-3-(2,3,5-trimethylphenoxy)chromen-7-yl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 7905505 |
| Molecular Formula | C33H33F3NO7+ |
| Molecular Weight | 612.62 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | [8-(morpholin-4-ium-4-ylmethyl)-4-oxo-2-(trifluoromethyl)-3-(2,3,5-trimethylphenoxy)chromen-7-yl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc3c(=O)c(Oc4cc(C)cc(C)c4C)c(C(F)(F)F)oc3c2C[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C33H32F3NO7/c1-5-41-23-8-6-22(7-9-23)32(39)43-26-11-10-24-28(38)30(42-27-17-19(2)16-20(3)21(27)4)31(33(34,35)36)44-29(24)25(26)18-37-12-14-40-15-13-37/h6-11,16-17H,5,12-15,18H2,1-4H3/p+1 |
| InChIKey | PHRWWLKUJDPKQX-UHFFFAOYSA-O |
| XLogP | 5.56 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|