C32H30F3NO8 — CID 7905476
[3-(3,4-dimethylphenoxy)-8-(morpholin-4-ylmethyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate (PubChem CID 7905476) has the molecular formula C32H30F3NO8 and a molecular weight of 613.59 g/mol. Its IUPAC name is [3-(3,4-dimethylphenoxy)-8-(morpholin-4-ylmethyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate.
| Compound Name | [3-(3,4-dimethylphenoxy)-8-(morpholin-4-ylmethyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 7905476 |
| Molecular Formula | C32H30F3NO8 |
| Molecular Weight | 613.59 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | [3-(3,4-dimethylphenoxy)-8-(morpholin-4-ylmethyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3c(=O)c(Oc4ccc(C)c(C)c4)c(C(F)(F)F)oc3c2CN2CCOCC2)cc1OC |
| InChI | InChI=1S/C32H30F3NO8/c1-18-5-7-21(15-19(18)2)42-29-27(37)22-8-10-24(43-31(38)20-6-9-25(39-3)26(16-20)40-4)23(17-36-11-13-41-14-12-36)28(22)44-30(29)32(33,34)35/h5-10,15-16H,11-14,17H2,1-4H3 |
| InChIKey | HRRJSYHIMOOJGC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 96.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|