C41H48F3NO5 — CID 71967263
[8-[[bis(2-methylpropyl)amino]methyl]-4-oxo-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 3-(4-tert-butylphenyl)prop-2-enoate (PubChem CID 71967263) has the molecular formula C41H48F3NO5 and a molecular weight of 691.83 g/mol. Its IUPAC name is [8-[[bis(2-methylpropyl)amino]methyl]-4-oxo-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 3-(4-tert-butylphenyl)prop-2-enoate.
| Compound Name | [8-[[bis(2-methylpropyl)amino]methyl]-4-oxo-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 3-(4-tert-butylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71967263 |
| Molecular Formula | C41H48F3NO5 |
| Molecular Weight | 691.83 g/mol |
| Exact Mass | 691.35 |
| IUPAC Name | [8-[[bis(2-methylpropyl)amino]methyl]-4-oxo-3-(4-propylphenoxy)-2-(trifluoromethyl)chromen-7-yl] 3-(4-tert-butylphenyl)prop-2-enoate |
| SMILES | CCCc1ccc(Oc2c(C(F)(F)F)oc3c(CN(CC(C)C)CC(C)C)c(OC(=O)C=Cc4ccc(C(C)(C)C)cc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C41H48F3NO5/c1-9-10-28-13-18-31(19-14-28)48-38-36(47)32-20-21-34(49-35(46)22-15-29-11-16-30(17-12-29)40(6,7)8)33(37(32)50-39(38)41(42,43)44)25-45(23-26(2)3)24-27(4)5/h11-22,26-27H,9-10,23-25H2,1-8H3 |
| InChIKey | PUAYBQMBUXOMCT-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.83 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|