C23H20F3O9- — CID 78577500
7-hydroxy-3-(4-methoxyphenoxy)-8-(2-methylpropyl)-2-(trifluoromethyl)chromen-4-one;2-hydroxy-2-oxoacetate (PubChem CID 78577500) has the molecular formula C23H20F3O9- and a molecular weight of 497.40 g/mol. Its IUPAC name is 7-hydroxy-3-(4-methoxyphenoxy)-8-(2-methylpropyl)-2-(trifluoromethyl)chromen-4-one;2-hydroxy-2-oxoacetate.
| Compound Name | 7-hydroxy-3-(4-methoxyphenoxy)-8-(2-methylpropyl)-2-(trifluoromethyl)chromen-4-one;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 78577500 |
| Molecular Formula | C23H20F3O9- |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 7-hydroxy-3-(4-methoxyphenoxy)-8-(2-methylpropyl)-2-(trifluoromethyl)chromen-4-one;2-hydroxy-2-oxoacetate |
| SMILES | COc1ccc(Oc2c(C(F)(F)F)oc3c(CC(C)C)c(O)ccc3c2=O)cc1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C21H19F3O5.C2H2O4/c1-11(2)10-15-16(25)9-8-14-17(26)19(20(21(22,23)24)29-18(14)15)28-13-6-4-12(27-3)5-7-13;3-1(4)2(5)6/h4-9,11,25H,10H2,1-3H3;(H,3,4)(H,5,6)/p-1 |
| InChIKey | BWQBIPNGTMGXCQ-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|