C31H29F3N2O6 — CID 95399348
propyl 4-[7-hydroxy-4-oxo-8-[(4-phenylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate (PubChem CID 95399348) has the molecular formula C31H29F3N2O6 and a molecular weight of 582.58 g/mol. Its IUPAC name is propyl 4-[7-hydroxy-4-oxo-8-[(4-phenylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate.
| Compound Name | propyl 4-[7-hydroxy-4-oxo-8-[(4-phenylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
|---|---|
| PubChem CID | 95399348 |
| Molecular Formula | C31H29F3N2O6 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | propyl 4-[7-hydroxy-4-oxo-8-[(4-phenylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
| SMILES | CCCOC(=O)c1ccc(Oc2c(C(F)(F)F)oc3c(CN4CCN(c5ccccc5)CC4)c(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C31H29F3N2O6/c1-2-18-40-30(39)20-8-10-22(11-9-20)41-28-26(38)23-12-13-25(37)24(27(23)42-29(28)31(32,33)34)19-35-14-16-36(17-15-35)21-6-4-3-5-7-21/h3-13,37H,2,14-19H2,1H3 |
| InChIKey | NCRHZHWAVYTVJY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|