C29H26F4N2O5 — CID 95399451
3-(2-ethoxyphenoxy)-8-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one (PubChem CID 95399451) has the molecular formula C29H26F4N2O5 and a molecular weight of 558.53 g/mol. Its IUPAC name is 3-(2-ethoxyphenoxy)-8-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(2-ethoxyphenoxy)-8-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 95399451 |
| Molecular Formula | C29H26F4N2O5 |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 3-(2-ethoxyphenoxy)-8-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
| SMILES | CCOc1ccccc1Oc1c(C(F)(F)F)oc2c(CN3CCN(c4ccc(F)cc4)CC3)c(O)ccc2c1=O |
| InChI | InChI=1S/C29H26F4N2O5/c1-2-38-23-5-3-4-6-24(23)39-27-25(37)20-11-12-22(36)21(26(20)40-28(27)29(31,32)33)17-34-13-15-35(16-14-34)19-9-7-18(30)8-10-19/h3-12,36H,2,13-17H2,1H3 |
| InChIKey | ZATDATJWAZUBTC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|