C32H24ClF3O6 — CID 2074828
[3-naphthalen-2-yloxy-4-oxo-2-(trifluoromethyl)chromen-7-yl] 4-(4-chloro-3,5-dimethylphenoxy)butanoate (PubChem CID 2074828) has the molecular formula C32H24ClF3O6 and a molecular weight of 596.99 g/mol. Its IUPAC name is [3-naphthalen-2-yloxy-4-oxo-2-(trifluoromethyl)chromen-7-yl] 4-(4-chloro-3,5-dimethylphenoxy)butanoate.
| Compound Name | [3-naphthalen-2-yloxy-4-oxo-2-(trifluoromethyl)chromen-7-yl] 4-(4-chloro-3,5-dimethylphenoxy)butanoate |
|---|---|
| PubChem CID | 2074828 |
| Molecular Formula | C32H24ClF3O6 |
| Molecular Weight | 596.99 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | [3-naphthalen-2-yloxy-4-oxo-2-(trifluoromethyl)chromen-7-yl] 4-(4-chloro-3,5-dimethylphenoxy)butanoate |
| SMILES | Cc1cc(OCCCC(=O)Oc2ccc3c(=O)c(Oc4ccc5ccccc5c4)c(C(F)(F)F)oc3c2)cc(C)c1Cl |
| InChI | InChI=1S/C32H24ClF3O6/c1-18-14-24(15-19(2)28(18)33)39-13-5-8-27(37)40-23-11-12-25-26(17-23)42-31(32(34,35)36)30(29(25)38)41-22-10-9-20-6-3-4-7-21(20)16-22/h3-4,6-7,9-12,14-17H,5,8,13H2,1-2H3 |
| InChIKey | HIGZMQQHGOKPBZ-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.99 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|