C26H21F3O6 — CID 2337444
ethyl 2-[6-ethyl-3-naphthalen-2-yloxy-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetate (PubChem CID 2337444) has the molecular formula C26H21F3O6 and a molecular weight of 486.44 g/mol. Its IUPAC name is ethyl 2-[6-ethyl-3-naphthalen-2-yloxy-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetate.
| Compound Name | ethyl 2-[6-ethyl-3-naphthalen-2-yloxy-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 2337444 |
| Molecular Formula | C26H21F3O6 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | ethyl 2-[6-ethyl-3-naphthalen-2-yloxy-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetate |
| SMILES | CCOC(=O)COc1cc2oc(C(F)(F)F)c(Oc3ccc4ccccc4c3)c(=O)c2cc1CC |
| InChI | InChI=1S/C26H21F3O6/c1-3-15-12-19-21(13-20(15)33-14-22(30)32-4-2)35-25(26(27,28)29)24(23(19)31)34-18-10-9-16-7-5-6-8-17(16)11-18/h5-13H,3-4,14H2,1-2H3 |
| InChIKey | LCTUPABHMVRMFX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |