C26H18BrF3O6 — CID 2312977
[6-ethyl-4-oxo-3-phenoxy-2-(trifluoromethyl)chromen-7-yl] 2-(4-bromophenoxy)acetate (PubChem CID 2312977) has the molecular formula C26H18BrF3O6 and a molecular weight of 563.32 g/mol. Its IUPAC name is [6-ethyl-4-oxo-3-phenoxy-2-(trifluoromethyl)chromen-7-yl] 2-(4-bromophenoxy)acetate.
| Compound Name | [6-ethyl-4-oxo-3-phenoxy-2-(trifluoromethyl)chromen-7-yl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 2312977 |
| Molecular Formula | C26H18BrF3O6 |
| Molecular Weight | 563.32 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | [6-ethyl-4-oxo-3-phenoxy-2-(trifluoromethyl)chromen-7-yl] 2-(4-bromophenoxy)acetate |
| SMILES | CCc1cc2c(=O)c(Oc3ccccc3)c(C(F)(F)F)oc2cc1OC(=O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H18BrF3O6/c1-2-15-12-19-21(13-20(15)35-22(31)14-33-17-10-8-16(27)9-11-17)36-25(26(28,29)30)24(23(19)32)34-18-6-4-3-5-7-18/h3-13H,2,14H2,1H3 |
| InChIKey | UVNMIHTWRVEWJM-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.32 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|