C23H21F3O6 — CID 1182848
2-methylpropyl 2-[3-(3-methylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetate (PubChem CID 1182848) has the molecular formula C23H21F3O6 and a molecular weight of 450.41 g/mol. Its IUPAC name is 2-methylpropyl 2-[3-(3-methylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetate.
| Compound Name | 2-methylpropyl 2-[3-(3-methylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 1182848 |
| Molecular Formula | C23H21F3O6 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-methylpropyl 2-[3-(3-methylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetate |
| SMILES | Cc1cccc(Oc2c(C(F)(F)F)oc3cc(OCC(=O)OCC(C)C)ccc3c2=O)c1 |
| InChI | InChI=1S/C23H21F3O6/c1-13(2)11-30-19(27)12-29-15-7-8-17-18(10-15)32-22(23(24,25)26)21(20(17)28)31-16-6-4-5-14(3)9-16/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | LIKQJSPISUWVIQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |