C28H24F3NO5 — CID 2351771
N-(2-ethoxyphenyl)-2-[6-ethyl-4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl]oxyacetamide (PubChem CID 2351771) has the molecular formula C28H24F3NO5 and a molecular weight of 511.50 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[6-ethyl-4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl]oxyacetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[6-ethyl-4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 2351771 |
| Molecular Formula | C28H24F3NO5 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[6-ethyl-4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl]oxyacetamide |
| SMILES | CCOc1ccccc1NC(=O)COc1cc2oc(C(F)(F)F)c(-c3ccccc3)c(=O)c2cc1CC |
| InChI | InChI=1S/C28H24F3NO5/c1-3-17-14-19-23(37-27(28(29,30)31)25(26(19)34)18-10-6-5-7-11-18)15-22(17)36-16-24(33)32-20-12-8-9-13-21(20)35-4-2/h5-15H,3-4,16H2,1-2H3,(H,32,33) |
| InChIKey | YEDCPSSOGTZMOA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |