C22H12BrClF3NO6 — CID 95398566
[3-(2-bromophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(3-chloro-1,2-oxazol-5-yl)propanoate (PubChem CID 95398566) has the molecular formula C22H12BrClF3NO6 and a molecular weight of 558.69 g/mol. Its IUPAC name is [3-(2-bromophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(3-chloro-1,2-oxazol-5-yl)propanoate.
| Compound Name | [3-(2-bromophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(3-chloro-1,2-oxazol-5-yl)propanoate |
|---|---|
| PubChem CID | 95398566 |
| Molecular Formula | C22H12BrClF3NO6 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 556.95 |
| IUPAC Name | [3-(2-bromophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(3-chloro-1,2-oxazol-5-yl)propanoate |
| SMILES | O=C(CCc1cc(Cl)no1)Oc1ccc2c(=O)c(Oc3ccccc3Br)c(C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C22H12BrClF3NO6/c23-14-3-1-2-4-15(14)32-20-19(30)13-7-5-11(9-16(13)33-21(20)22(25,26)27)31-18(29)8-6-12-10-17(24)28-34-12/h1-5,7,9-10H,6,8H2 |
| InChIKey | JXGQCNNALRRXPR-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 91.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|