C26H19ClF3NO8 — CID 95398564
propyl 4-[7-[3-(3-chloro-1,2-oxazol-5-yl)propanoyloxy]-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate (PubChem CID 95398564) has the molecular formula C26H19ClF3NO8 and a molecular weight of 565.88 g/mol. Its IUPAC name is propyl 4-[7-[3-(3-chloro-1,2-oxazol-5-yl)propanoyloxy]-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate.
| Compound Name | propyl 4-[7-[3-(3-chloro-1,2-oxazol-5-yl)propanoyloxy]-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
|---|---|
| PubChem CID | 95398564 |
| Molecular Formula | C26H19ClF3NO8 |
| Molecular Weight | 565.88 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | propyl 4-[7-[3-(3-chloro-1,2-oxazol-5-yl)propanoyloxy]-4-oxo-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
| SMILES | CCCOC(=O)c1ccc(Oc2c(C(F)(F)F)oc3cc(OC(=O)CCc4cc(Cl)no4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C26H19ClF3NO8/c1-2-11-35-25(34)14-3-5-15(6-4-14)37-23-22(33)18-9-7-16(12-19(18)38-24(23)26(28,29)30)36-21(32)10-8-17-13-20(27)31-39-17/h3-7,9,12-13H,2,8,10-11H2,1H3 |
| InChIKey | DKYIKEJIVWCBKD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 118.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.88 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|