C22H12BrF3O5S — CID 95398519
[3-(2-bromophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-thiophen-2-ylacetate (PubChem CID 95398519) has the molecular formula C22H12BrF3O5S and a molecular weight of 525.30 g/mol. Its IUPAC name is [3-(2-bromophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-thiophen-2-ylacetate.
| Compound Name | [3-(2-bromophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 95398519 |
| Molecular Formula | C22H12BrF3O5S |
| Molecular Weight | 525.30 g/mol |
| Exact Mass | 523.95 |
| IUPAC Name | [3-(2-bromophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-thiophen-2-ylacetate |
| SMILES | O=C(Cc1cccs1)Oc1ccc2c(=O)c(Oc3ccccc3Br)c(C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C22H12BrF3O5S/c23-15-5-1-2-6-16(15)30-20-19(28)14-8-7-12(10-17(14)31-21(20)22(24,25)26)29-18(27)11-13-4-3-9-32-13/h1-10H,11H2 |
| InChIKey | QSXDBLJSQXQVDG-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.30 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|