C22H13F3O6S — CID 2002963
[3-(2-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] thiophene-2-carboxylate (PubChem CID 2002963) has the molecular formula C22H13F3O6S and a molecular weight of 462.40 g/mol. Its IUPAC name is [3-(2-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] thiophene-2-carboxylate.
| Compound Name | [3-(2-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2002963 |
| Molecular Formula | C22H13F3O6S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | [3-(2-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] thiophene-2-carboxylate |
| SMILES | COc1ccccc1Oc1c(C(F)(F)F)oc2cc(OC(=O)c3cccs3)ccc2c1=O |
| InChI | InChI=1S/C22H13F3O6S/c1-28-14-5-2-3-6-15(14)30-19-18(26)13-9-8-12(29-21(27)17-7-4-10-32-17)11-16(13)31-20(19)22(23,24)25/h2-11H,1H3 |
| InChIKey | LSFAZYHEQRIGRA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|