C29H21F3O8 — CID 4670583
[3-(3,4-dimethoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate (PubChem CID 4670583) has the molecular formula C29H21F3O8 and a molecular weight of 554.47 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4670583 |
| Molecular Formula | C29H21F3O8 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
| SMILES | COc1ccc(-c2c(C(F)(F)F)oc3cc(OC(=O)C=Cc4ccc5c(c4)OCCO5)ccc3c2=O)cc1OC |
| InChI | InChI=1S/C29H21F3O8/c1-35-20-9-5-17(14-23(20)36-2)26-27(34)19-7-6-18(15-22(19)40-28(26)29(30,31)32)39-25(33)10-4-16-3-8-21-24(13-16)38-12-11-37-21/h3-10,13-15H,11-12H2,1-2H3 |
| InChIKey | JBAKOCYXXKREQK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|