C25H15F3O7 — CID 2024782
[3-(4-methoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 1,3-benzodioxole-5-carboxylate (PubChem CID 2024782) has the molecular formula C25H15F3O7 and a molecular weight of 484.38 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [3-(4-methoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 2024782 |
| Molecular Formula | C25H15F3O7 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [3-(4-methoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1ccc(-c2c(C(F)(F)F)oc3cc(OC(=O)c4ccc5c(c4)OCO5)ccc3c2=O)cc1 |
| InChI | InChI=1S/C25H15F3O7/c1-31-15-5-2-13(3-6-15)21-22(29)17-8-7-16(11-19(17)35-23(21)25(26,27)28)34-24(30)14-4-9-18-20(10-14)33-12-32-18/h2-11H,12H2,1H3 |
| InChIKey | FGCJCUCCNSAILD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|