C19H11ClF3O5- — CID 6973391
(2S)-2-[3-(4-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxypropanoate (PubChem CID 6973391) has the molecular formula C19H11ClF3O5- and a molecular weight of 411.74 g/mol. Its IUPAC name is (2S)-2-[3-(4-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxypropanoate.
| Compound Name | (2S)-2-[3-(4-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxypropanoate |
|---|---|
| PubChem CID | 6973391 |
| Molecular Formula | C19H11ClF3O5- |
| Molecular Weight | 411.74 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | (2S)-2-[3-(4-chlorophenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxypropanoate |
| SMILES | C[C@H](Oc1ccc2c(=O)c(-c3ccc(Cl)cc3)c(C(F)(F)F)oc2c1)C(=O)[O-] |
| InChI | InChI=1S/C19H12ClF3O5/c1-9(18(25)26)27-12-6-7-13-14(8-12)28-17(19(21,22)23)15(16(13)24)10-2-4-11(20)5-3-10/h2-9H,1H3,(H,25,26)/p-1/t9-/m0/s1 |
| InChIKey | YPROHFBQSFVDGY-VIFPVBQESA-M |
| XLogP | 3.65 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.74 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |