C21H15F3O5 — CID 3396308
prop-2-enyl 2-[4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl]oxyacetate (PubChem CID 3396308) has the molecular formula C21H15F3O5 and a molecular weight of 404.34 g/mol. Its IUPAC name is prop-2-enyl 2-[4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl]oxyacetate.
| Compound Name | prop-2-enyl 2-[4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 3396308 |
| Molecular Formula | C21H15F3O5 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | prop-2-enyl 2-[4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl]oxyacetate |
| SMILES | C=CCOC(=O)COc1ccc2c(=O)c(-c3ccccc3)c(C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C21H15F3O5/c1-2-10-27-17(25)12-28-14-8-9-15-16(11-14)29-20(21(22,23)24)18(19(15)26)13-6-4-3-5-7-13/h2-9,11H,1,10,12H2 |
| InChIKey | GCDJHRWXCJLZCV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|