C36H39N3O8 — CID 142657995
[(2S)-1-[3,3-bis[4-(methoxycarbonylamino)phenyl]propylamino]-3-phenoxypropan-2-yl] (2S)-2-hydroxy-2-phenylacetate (PubChem CID 142657995) has the molecular formula C36H39N3O8 and a molecular weight of 641.72 g/mol. Its IUPAC name is [(2S)-1-[3,3-bis[4-(methoxycarbonylamino)phenyl]propylamino]-3-phenoxypropan-2-yl] (2S)-2-hydroxy-2-phenylacetate.
| Compound Name | [(2S)-1-[3,3-bis[4-(methoxycarbonylamino)phenyl]propylamino]-3-phenoxypropan-2-yl] (2S)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 142657995 |
| Molecular Formula | C36H39N3O8 |
| Molecular Weight | 641.72 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | [(2S)-1-[3,3-bis[4-(methoxycarbonylamino)phenyl]propylamino]-3-phenoxypropan-2-yl] (2S)-2-hydroxy-2-phenylacetate |
| SMILES | COC(=O)Nc1ccc(C(CCNC[C@@H](COc2ccccc2)OC(=O)[C@@H](O)c2ccccc2)c2ccc(NC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C36H39N3O8/c1-44-35(42)38-28-17-13-25(14-18-28)32(26-15-19-29(20-16-26)39-36(43)45-2)21-22-37-23-31(24-46-30-11-7-4-8-12-30)47-34(41)33(40)27-9-5-3-6-10-27/h3-20,31-33,37,40H,21-24H2,1-2H3,(H,38,42)(H,39,43)/t31-,33-/m0/s1 |
| InChIKey | HFHDJVOHHCDCNY-WEZIJMHWSA-N |
| XLogP | 5.88 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|