C22H33N3O8 — CID 70527681
2-[1-(2-methylphenoxy)-3-[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]ethylamino]propan-2-yl]oxy-2-oxoacetic acid (PubChem CID 70527681) has the molecular formula C22H33N3O8 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[1-(2-methylphenoxy)-3-[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]ethylamino]propan-2-yl]oxy-2-oxoacetic acid.
| Compound Name | 2-[1-(2-methylphenoxy)-3-[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]ethylamino]propan-2-yl]oxy-2-oxoacetic acid |
|---|---|
| PubChem CID | 70527681 |
| Molecular Formula | C22H33N3O8 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 2-[1-(2-methylphenoxy)-3-[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]ethylamino]propan-2-yl]oxy-2-oxoacetic acid |
| SMILES | Cc1ccccc1OCC(CNCCNC(=O)CCNC(=O)OC(C)(C)C)OC(=O)C(=O)O |
| InChI | InChI=1S/C22H33N3O8/c1-15-7-5-6-8-17(15)31-14-16(32-20(29)19(27)28)13-23-11-12-24-18(26)9-10-25-21(30)33-22(2,3)4/h5-8,16,23H,9-14H2,1-4H3,(H,24,26)(H,25,30)(H,27,28) |
| InChIKey | MMKJGKUYARDKGI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|