C30H32N2O7S — CID 91136445
N-[5-[(2S)-3-[3,3-bis(4-hydroxyphenyl)propylamino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide (PubChem CID 91136445) has the molecular formula C30H32N2O7S and a molecular weight of 564.66 g/mol. Its IUPAC name is N-[5-[(2S)-3-[3,3-bis(4-hydroxyphenyl)propylamino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide.
| Compound Name | N-[5-[(2S)-3-[3,3-bis(4-hydroxyphenyl)propylamino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91136445 |
| Molecular Formula | C30H32N2O7S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | N-[5-[(2S)-3-[3,3-bis(4-hydroxyphenyl)propylamino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(OC[C@@H](O)CNCCC(c2ccc(O)cc2)c2ccc(O)cc2)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O7S/c33-23-10-6-21(7-11-23)28(22-8-12-24(34)13-9-22)16-17-31-19-25(35)20-39-26-14-15-30(36)29(18-26)32-40(37,38)27-4-2-1-3-5-27/h1-15,18,25,28,31-36H,16-17,19-20H2/t25-/m0/s1 |
| InChIKey | FMLOETUMBPGYAF-VWLOTQADSA-N |
| XLogP | 4.16 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|