C31H34N2O7S — CID 70144041
N-[5-[1-[2,2-bis(4-methoxyphenyl)ethylamino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide (PubChem CID 70144041) has the molecular formula C31H34N2O7S and a molecular weight of 578.69 g/mol. Its IUPAC name is N-[5-[1-[2,2-bis(4-methoxyphenyl)ethylamino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide.
| Compound Name | N-[5-[1-[2,2-bis(4-methoxyphenyl)ethylamino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70144041 |
| Molecular Formula | C31H34N2O7S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | N-[5-[1-[2,2-bis(4-methoxyphenyl)ethylamino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide |
| SMILES | COc1ccc(C(CNC(Oc2ccc(O)c(NS(=O)(=O)c3ccccc3)c2)C(C)O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H34N2O7S/c1-21(34)31(40-26-17-18-30(35)29(19-26)33-41(36,37)27-7-5-4-6-8-27)32-20-28(22-9-13-24(38-2)14-10-22)23-11-15-25(39-3)16-12-23/h4-19,21,28,31-35H,20H2,1-3H3 |
| InChIKey | OAIWAFKTYMMQCV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|