C22H22N2O6S — CID 18928962
3-(benzenesulfonamido)-N-[2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)ethyl]benzamide (PubChem CID 18928962) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)ethyl]benzamide.
| Compound Name | 3-(benzenesulfonamido)-N-[2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 18928962 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1cc(C(O)CNC(=O)c2cccc(NS(=O)(=O)c3ccccc3)c2)ccc1O |
| InChI | InChI=1S/C22H22N2O6S/c1-30-21-13-15(10-11-19(21)25)20(26)14-23-22(27)16-6-5-7-17(12-16)24-31(28,29)18-8-3-2-4-9-18/h2-13,20,24-26H,14H2,1H3,(H,23,27) |
| InChIKey | JPMCUWPZIOBDNE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |