C24H27FN2O6S — CID 70034937
4-fluoro-N-[2-hydroxy-5-[(2S)-3-hydroxy-2-[[(2S)-2-hydroxy-1-phenoxypropyl]amino]propyl]phenyl]benzenesulfonamide (PubChem CID 70034937) has the molecular formula C24H27FN2O6S and a molecular weight of 490.55 g/mol. Its IUPAC name is 4-fluoro-N-[2-hydroxy-5-[(2S)-3-hydroxy-2-[[(2S)-2-hydroxy-1-phenoxypropyl]amino]propyl]phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-hydroxy-5-[(2S)-3-hydroxy-2-[[(2S)-2-hydroxy-1-phenoxypropyl]amino]propyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70034937 |
| Molecular Formula | C24H27FN2O6S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 4-fluoro-N-[2-hydroxy-5-[(2S)-3-hydroxy-2-[[(2S)-2-hydroxy-1-phenoxypropyl]amino]propyl]phenyl]benzenesulfonamide |
| SMILES | C[C@H](O)C(N[C@H](CO)Cc1ccc(O)c(NS(=O)(=O)c2ccc(F)cc2)c1)Oc1ccccc1 |
| InChI | InChI=1S/C24H27FN2O6S/c1-16(29)24(33-20-5-3-2-4-6-20)26-19(15-28)13-17-7-12-23(30)22(14-17)27-34(31,32)21-10-8-18(25)9-11-21/h2-12,14,16,19,24,26-30H,13,15H2,1H3/t16-,19-,24?/m0/s1 |
| InChIKey | HVAXGGCUJXNJEE-OZLDRJBTSA-N |
| XLogP | 2.61 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|