C24H25NO4S — CID 146146612
N-(5-benzyl-2-hydroxyphenyl)-4-cyclopentyloxybenzenesulfonamide (PubChem CID 146146612) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is N-(5-benzyl-2-hydroxyphenyl)-4-cyclopentyloxybenzenesulfonamide.
| Compound Name | N-(5-benzyl-2-hydroxyphenyl)-4-cyclopentyloxybenzenesulfonamide |
|---|---|
| PubChem CID | 146146612 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-(5-benzyl-2-hydroxyphenyl)-4-cyclopentyloxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cc2ccccc2)ccc1O)c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C24H25NO4S/c26-24-15-10-19(16-18-6-2-1-3-7-18)17-23(24)25-30(27,28)22-13-11-21(12-14-22)29-20-8-4-5-9-20/h1-3,6-7,10-15,17,20,25-26H,4-5,8-9,16H2 |
| InChIKey | AAOMLLPSLIHGIW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|