C21H18FNO5S — CID 146146613
5-[(5-benzyl-2-hydroxyphenyl)sulfamoyl]-3-fluoro-2-methylbenzoic acid (PubChem CID 146146613) has the molecular formula C21H18FNO5S and a molecular weight of 415.44 g/mol. Its IUPAC name is 5-[(5-benzyl-2-hydroxyphenyl)sulfamoyl]-3-fluoro-2-methylbenzoic acid.
| Compound Name | 5-[(5-benzyl-2-hydroxyphenyl)sulfamoyl]-3-fluoro-2-methylbenzoic acid |
|---|---|
| PubChem CID | 146146613 |
| Molecular Formula | C21H18FNO5S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 5-[(5-benzyl-2-hydroxyphenyl)sulfamoyl]-3-fluoro-2-methylbenzoic acid |
| SMILES | Cc1c(F)cc(S(=O)(=O)Nc2cc(Cc3ccccc3)ccc2O)cc1C(=O)O |
| InChI | InChI=1S/C21H18FNO5S/c1-13-17(21(25)26)11-16(12-18(13)22)29(27,28)23-19-10-15(7-8-20(19)24)9-14-5-3-2-4-6-14/h2-8,10-12,23-24H,9H2,1H3,(H,25,26) |
| InChIKey | IFYHOUPRWZOMCJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|