C21H18N2O7S — CID 141031892
7-[(3,4-dihydroxyphenyl)methyl]-3-(methylsulfamoyl)-10H-phenoxazine-1-carboxylic acid (PubChem CID 141031892) has the molecular formula C21H18N2O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is 7-[(3,4-dihydroxyphenyl)methyl]-3-(methylsulfamoyl)-10H-phenoxazine-1-carboxylic acid.
| Compound Name | 7-[(3,4-dihydroxyphenyl)methyl]-3-(methylsulfamoyl)-10H-phenoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141031892 |
| Molecular Formula | C21H18N2O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 7-[(3,4-dihydroxyphenyl)methyl]-3-(methylsulfamoyl)-10H-phenoxazine-1-carboxylic acid |
| SMILES | CNS(=O)(=O)c1cc2c(c(C(=O)O)c1)Nc1ccc(Cc3ccc(O)c(O)c3)cc1O2 |
| InChI | InChI=1S/C21H18N2O7S/c1-22-31(28,29)13-9-14(21(26)27)20-19(10-13)30-18-8-12(2-4-15(18)23-20)6-11-3-5-16(24)17(25)7-11/h2-5,7-10,22-25H,6H2,1H3,(H,26,27) |
| InChIKey | HBKONXDUMQYQAD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|