C24H21NO5 — CID 141031846
8-[2-(3,4-dimethylphenyl)ethyl]-10H-phenoxazine-1,3-dicarboxylic acid (PubChem CID 141031846) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is 8-[2-(3,4-dimethylphenyl)ethyl]-10H-phenoxazine-1,3-dicarboxylic acid.
| Compound Name | 8-[2-(3,4-dimethylphenyl)ethyl]-10H-phenoxazine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141031846 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 8-[2-(3,4-dimethylphenyl)ethyl]-10H-phenoxazine-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(CCc2ccc3c(c2)Nc2c(cc(C(=O)O)cc2C(=O)O)O3)cc1C |
| InChI | InChI=1S/C24H21NO5/c1-13-3-4-15(9-14(13)2)5-6-16-7-8-20-19(10-16)25-22-18(24(28)29)11-17(23(26)27)12-21(22)30-20/h3-4,7-12,25H,5-6H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | KVXXNQJYWGAWIM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |