C14H9NO7 — CID 141032051
7,8-dihydroxy-10H-phenoxazine-1,3-dicarboxylic acid (PubChem CID 141032051) has the molecular formula C14H9NO7 and a molecular weight of 303.23 g/mol. Its IUPAC name is 7,8-dihydroxy-10H-phenoxazine-1,3-dicarboxylic acid.
| Compound Name | 7,8-dihydroxy-10H-phenoxazine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141032051 |
| Molecular Formula | C14H9NO7 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 7,8-dihydroxy-10H-phenoxazine-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc2c(c(C(=O)O)c1)Nc1cc(O)c(O)cc1O2 |
| InChI | InChI=1S/C14H9NO7/c16-8-3-7-10(4-9(8)17)22-11-2-5(13(18)19)1-6(14(20)21)12(11)15-7/h1-4,15-17H,(H,18,19)(H,20,21) |
| InChIKey | QTTKDFXCDSDVOK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|