C21H15NO7 — CID 141031949
7-[(3,4-dihydroxyphenyl)methyl]-10H-phenoxazine-1,3-dicarboxylic acid (PubChem CID 141031949) has the molecular formula C21H15NO7 and a molecular weight of 393.35 g/mol. Its IUPAC name is 7-[(3,4-dihydroxyphenyl)methyl]-10H-phenoxazine-1,3-dicarboxylic acid.
| Compound Name | 7-[(3,4-dihydroxyphenyl)methyl]-10H-phenoxazine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141031949 |
| Molecular Formula | C21H15NO7 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 7-[(3,4-dihydroxyphenyl)methyl]-10H-phenoxazine-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc2c(c(C(=O)O)c1)Nc1ccc(Cc3ccc(O)c(O)c3)cc1O2 |
| InChI | InChI=1S/C21H15NO7/c23-15-4-2-10(6-16(15)24)5-11-1-3-14-17(7-11)29-18-9-12(20(25)26)8-13(21(27)28)19(18)22-14/h1-4,6-9,22-24H,5H2,(H,25,26)(H,27,28) |
| InChIKey | SQYCIXZHYCCAQS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|