C21H13ClF3NO3 — CID 10223854
7-[[3-chloro-4-(trifluoromethyl)phenyl]methyl]-10H-phenoxazine-1-carboxylic acid (PubChem CID 10223854) has the molecular formula C21H13ClF3NO3 and a molecular weight of 419.79 g/mol. Its IUPAC name is 7-[[3-chloro-4-(trifluoromethyl)phenyl]methyl]-10H-phenoxazine-1-carboxylic acid.
| Compound Name | 7-[[3-chloro-4-(trifluoromethyl)phenyl]methyl]-10H-phenoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 10223854 |
| Molecular Formula | C21H13ClF3NO3 |
| Molecular Weight | 419.79 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 7-[[3-chloro-4-(trifluoromethyl)phenyl]methyl]-10H-phenoxazine-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1Nc1ccc(Cc3ccc(C(F)(F)F)c(Cl)c3)cc1O2 |
| InChI | InChI=1S/C21H13ClF3NO3/c22-15-9-11(4-6-14(15)21(23,24)25)8-12-5-7-16-18(10-12)29-17-3-1-2-13(20(27)28)19(17)26-16/h1-7,9-10,26H,8H2,(H,27,28) |
| InChIKey | WCTJEURBWWZXIL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |