C20H13Cl2NO3 — CID 10221728
8-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid (PubChem CID 10221728) has the molecular formula C20H13Cl2NO3 and a molecular weight of 386.23 g/mol. Its IUPAC name is 8-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid.
| Compound Name | 8-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 10221728 |
| Molecular Formula | C20H13Cl2NO3 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 8-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1Nc1cc(Cc3ccc(Cl)c(Cl)c3)ccc1O2 |
| InChI | InChI=1S/C20H13Cl2NO3/c21-14-6-4-11(9-15(14)22)8-12-5-7-17-16(10-12)23-19-13(20(24)25)2-1-3-18(19)26-17/h1-7,9-10,23H,8H2,(H,24,25) |
| InChIKey | KRCJRBAUOLTOGM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |