C25H16Cl2N2O5 — CID 10117509
7-[2-(3,4-dichlorophenyl)ethyl]-3-nitro-12H-benzo[i]phenoxazine-1-carboxylic acid (PubChem CID 10117509) has the molecular formula C25H16Cl2N2O5 and a molecular weight of 495.32 g/mol. Its IUPAC name is 7-[2-(3,4-dichlorophenyl)ethyl]-3-nitro-12H-benzo[i]phenoxazine-1-carboxylic acid.
| Compound Name | 7-[2-(3,4-dichlorophenyl)ethyl]-3-nitro-12H-benzo[i]phenoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 10117509 |
| Molecular Formula | C25H16Cl2N2O5 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 7-[2-(3,4-dichlorophenyl)ethyl]-3-nitro-12H-benzo[i]phenoxazine-1-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc2c1Nc1cc3cccc(CCc4ccc(Cl)c(Cl)c4)c3cc1O2 |
| InChI | InChI=1S/C25H16Cl2N2O5/c26-19-7-5-13(8-20(19)27)4-6-14-2-1-3-15-9-21-22(12-17(14)15)34-23-11-16(29(32)33)10-18(25(30)31)24(23)28-21/h1-3,5,7-12,28H,4,6H2,(H,30,31) |
| InChIKey | SUAFWIRCKWPFIX-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|