C18H12Cl2N2O5S — CID 141032052
8,9-dichloro-3-(methylsulfamoyl)-12H-benzo[i]phenoxazine-1-carboxylic acid (PubChem CID 141032052) has the molecular formula C18H12Cl2N2O5S and a molecular weight of 439.28 g/mol. Its IUPAC name is 8,9-dichloro-3-(methylsulfamoyl)-12H-benzo[i]phenoxazine-1-carboxylic acid.
| Compound Name | 8,9-dichloro-3-(methylsulfamoyl)-12H-benzo[i]phenoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141032052 |
| Molecular Formula | C18H12Cl2N2O5S |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 8,9-dichloro-3-(methylsulfamoyl)-12H-benzo[i]phenoxazine-1-carboxylic acid |
| SMILES | CNS(=O)(=O)c1cc2c(c(C(=O)O)c1)Nc1cc3cc(Cl)c(Cl)cc3cc1O2 |
| InChI | InChI=1S/C18H12Cl2N2O5S/c1-21-28(25,26)10-6-11(18(23)24)17-16(7-10)27-15-5-9-3-13(20)12(19)2-8(9)4-14(15)22-17/h2-7,21-22H,1H3,(H,23,24) |
| InChIKey | GMXMEQPTNZCOER-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |