C22H20N2O7S — CID 141032078
8-[2-(3,4-dihydroxyphenyl)ethyl]-3-(methylsulfamoyl)-10H-phenoxazine-1-carboxylic acid (PubChem CID 141032078) has the molecular formula C22H20N2O7S and a molecular weight of 456.48 g/mol. Its IUPAC name is 8-[2-(3,4-dihydroxyphenyl)ethyl]-3-(methylsulfamoyl)-10H-phenoxazine-1-carboxylic acid.
| Compound Name | 8-[2-(3,4-dihydroxyphenyl)ethyl]-3-(methylsulfamoyl)-10H-phenoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141032078 |
| Molecular Formula | C22H20N2O7S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 8-[2-(3,4-dihydroxyphenyl)ethyl]-3-(methylsulfamoyl)-10H-phenoxazine-1-carboxylic acid |
| SMILES | CNS(=O)(=O)c1cc2c(c(C(=O)O)c1)Nc1cc(CCc3ccc(O)c(O)c3)ccc1O2 |
| InChI | InChI=1S/C22H20N2O7S/c1-23-32(29,30)14-10-15(22(27)28)21-20(11-14)31-19-7-5-12(8-16(19)24-21)2-3-13-4-6-17(25)18(26)9-13/h4-11,23-26H,2-3H2,1H3,(H,27,28) |
| InChIKey | QZZPHWLJGQUXMO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|