C13H7Cl2NO3 — CID 59917041
7,8-dichloro-10H-phenoxazine-1-carboxylic acid (PubChem CID 59917041) has the molecular formula C13H7Cl2NO3 and a molecular weight of 296.11 g/mol. Its IUPAC name is 7,8-dichloro-10H-phenoxazine-1-carboxylic acid.
| Compound Name | 7,8-dichloro-10H-phenoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 59917041 |
| Molecular Formula | C13H7Cl2NO3 |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 7,8-dichloro-10H-phenoxazine-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1Nc1cc(Cl)c(Cl)cc1O2 |
| InChI | InChI=1S/C13H7Cl2NO3/c14-7-4-9-11(5-8(7)15)19-10-3-1-2-6(13(17)18)12(10)16-9/h1-5,16H,(H,17,18) |
| InChIKey | NYJKJNBANWRABM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |