C14H10N2O6 — CID 5487975
2-amino-3-hydroxy-10H-phenoxazine-1,9-dicarboxylic acid (PubChem CID 5487975) has the molecular formula C14H10N2O6 and a molecular weight of 302.24 g/mol. Its IUPAC name is 2-amino-3-hydroxy-10H-phenoxazine-1,9-dicarboxylic acid.
| Compound Name | 2-amino-3-hydroxy-10H-phenoxazine-1,9-dicarboxylic acid |
|---|---|
| PubChem CID | 5487975 |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-amino-3-hydroxy-10H-phenoxazine-1,9-dicarboxylic acid |
| SMILES | Nc1c(O)cc2c(c1C(=O)O)Nc1c(cccc1C(=O)O)O2 |
| InChI | InChI=1S/C14H10N2O6/c15-10-6(17)4-8-12(9(10)14(20)21)16-11-5(13(18)19)2-1-3-7(11)22-8/h1-4,16-17H,15H2,(H,18,19)(H,20,21) |
| InChIKey | NQTBTSGHHAQCGN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|