C22H15ClF3NO3 — CID 10203191
8-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethyl]-10H-phenoxazine-1-carboxylic acid (PubChem CID 10203191) has the molecular formula C22H15ClF3NO3 and a molecular weight of 433.81 g/mol. Its IUPAC name is 8-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethyl]-10H-phenoxazine-1-carboxylic acid.
| Compound Name | 8-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethyl]-10H-phenoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 10203191 |
| Molecular Formula | C22H15ClF3NO3 |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 8-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethyl]-10H-phenoxazine-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1Nc1cc(CCc3ccc(C(F)(F)F)c(Cl)c3)ccc1O2 |
| InChI | InChI=1S/C22H15ClF3NO3/c23-16-10-12(6-8-15(16)22(24,25)26)4-5-13-7-9-18-17(11-13)27-20-14(21(28)29)2-1-3-19(20)30-18/h1-3,6-11,27H,4-5H2,(H,28,29) |
| InChIKey | ZKSNKSFLHMZEOB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |